About bis[tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]sulfanyl]butanedioate
bis[tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]sulfanyl]butanedioate (PubChem CID 91697063) has the molecular formula C28H62O4S2Si4
and a molecular weight of 639.28 g/mol. Its IUPAC name is bis[tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]sulfanyl]butanedioate.
Molecular Properties
| Compound Name | bis[tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]sulfanyl]butanedioate |
| PubChem CID | 91697063 |
| Molecular Formula | C28H62O4S2Si4 |
| Molecular Weight | 639.28 g/mol |
| Exact Mass | 638.32 |
| IUPAC Name | bis[tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]sulfanyl]butanedioate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)C(S[Si](C)(C)C(C)(C)C)C(S[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H62O4S2Si4/c1-25(2,3)35(13,14)31-23(29)21(33-37(17,18)27(7,8)9)22(34-38(19,20)28(10,11)12)24(30)32-36(15,16)26(4,5)6/h21-22H,1-20H3 |
| InChIKey | JGYKPSQJNFKQGX-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 639.28 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis[tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]sulfanyl]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]sulfanyl]butanedioate?
The IUPAC name of bis[tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]sulfanyl]butanedioate (CID 91697063) is bis[tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]sulfanyl]butanedioate.
What is the SMILES notation for bis[tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]sulfanyl]butanedioate?
The canonical SMILES for bis[tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]sulfanyl]butanedioate is CC(C)(C)[Si](C)(C)OC(=O)C(S[Si](C)(C)C(C)(C)C)C(S[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of bis[tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]sulfanyl]butanedioate?
The InChIKey is JGYKPSQJNFKQGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H62O4S2Si4/c1-25(2,3)35(13,14)31-23(29)21(33-37(17,18)27(7,8)9)22(34-38(19,20)28(10,11)12)24(30)32-36(15,16)26(4,5)6/h21-22H,1-20H3.
What are the key properties of bis[tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]sulfanyl]butanedioate?
bis[tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]sulfanyl]butanedioate has a molecular weight of 639.28 g/mol, XLogP of 10.30, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]sulfanyl]butanedioate is sourced from PubChem (CID 91697063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).