C9H16N2O2Si — CID 91697316
trimethyl(4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-yloxy)silane (PubChem CID 91697316) has the molecular formula C9H16N2O2Si and a molecular weight of 212.32 g/mol. Its IUPAC name is trimethyl(4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-yloxy)silane.
| Compound Name | trimethyl(4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-yloxy)silane |
|---|---|
| PubChem CID | 91697316 |
| Molecular Formula | C9H16N2O2Si |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | trimethyl(4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-yloxy)silane |
| SMILES | C[Si](C)(C)Oc1noc2c1CCNC2 |
| InChI | InChI=1S/C9H16N2O2Si/c1-14(2,3)13-9-7-4-5-10-6-8(7)12-11-9/h10H,4-6H2,1-3H3 |
| InChIKey | NSYZOABMYMWDOU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|