About benzyl-dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane
benzyl-dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane (PubChem CID 91697336) has the molecular formula C19H30OSi
and a molecular weight of 302.53 g/mol. Its IUPAC name is benzyl-dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane.
Molecular Properties
| Compound Name | benzyl-dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane |
| PubChem CID | 91697336 |
| Molecular Formula | C19H30OSi |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | benzyl-dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane |
| SMILES | CC1(C)C2CCC1(C)C(O[Si](C)(C)Cc1ccccc1)C2 |
| InChI | InChI=1S/C19H30OSi/c1-18(2)16-11-12-19(18,3)17(13-16)20-21(4,5)14-15-9-7-6-8-10-15/h6-10,16-17H,11-14H2,1-5H3 |
| InChIKey | VSNCEBGYQWKTCT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzyl-dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane?
The IUPAC name of benzyl-dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane (CID 91697336) is benzyl-dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane.
What is the SMILES notation for benzyl-dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane?
The canonical SMILES for benzyl-dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane is CC1(C)C2CCC1(C)C(O[Si](C)(C)Cc1ccccc1)C2.
What is the InChIKey of benzyl-dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane?
The InChIKey is VSNCEBGYQWKTCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30OSi/c1-18(2)16-11-12-19(18,3)17(13-16)20-21(4,5)14-15-9-7-6-8-10-15/h6-10,16-17H,11-14H2,1-5H3.
What are the key properties of benzyl-dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane?
benzyl-dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane has a molecular weight of 302.53 g/mol, XLogP of 5.20, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane is sourced from PubChem (CID 91697336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).