C24H44O2Si — CID 91697369
[tert-butyl(dimethyl)silyl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate (PubChem CID 91697369) has the molecular formula C24H44O2Si and a molecular weight of 392.70 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate.
| Compound Name | [tert-butyl(dimethyl)silyl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 91697369 |
| Molecular Formula | C24H44O2Si |
| Molecular Weight | 392.70 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H44O2Si/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(25)26-27(5,6)24(2,3)4/h11-12,14-15,17-18H,7-10,13,16,19-22H2,1-6H3/b12-11-,15-14-,18-17- |
| InChIKey | HWTAEWWATVUJEK-IHDWIWDKSA-N |
| XLogP | 8.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.70 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|