About tert-butyl-dimethyl-(2,2,2-trifluoroethoxy)silane
tert-butyl-dimethyl-(2,2,2-trifluoroethoxy)silane (PubChem CID 91697408) has the molecular formula C8H17F3OSi
and a molecular weight of 214.30 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2,2,2-trifluoroethoxy)silane.
Molecular Properties
| Compound Name | tert-butyl-dimethyl-(2,2,2-trifluoroethoxy)silane |
| PubChem CID | 91697408 |
| Molecular Formula | C8H17F3OSi |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | tert-butyl-dimethyl-(2,2,2-trifluoroethoxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)OCC(F)(F)F |
| InChI | InChI=1S/C8H17F3OSi/c1-7(2,3)13(4,5)12-6-8(9,10)11/h6H2,1-5H3 |
| InChIKey | SXTLHVZNGHLKBQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethyl-(2,2,2-trifluoroethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethyl-(2,2,2-trifluoroethoxy)silane?
The IUPAC name of tert-butyl-dimethyl-(2,2,2-trifluoroethoxy)silane (CID 91697408) is tert-butyl-dimethyl-(2,2,2-trifluoroethoxy)silane.
What is the SMILES notation for tert-butyl-dimethyl-(2,2,2-trifluoroethoxy)silane?
The canonical SMILES for tert-butyl-dimethyl-(2,2,2-trifluoroethoxy)silane is CC(C)(C)[Si](C)(C)OCC(F)(F)F.
What is the InChIKey of tert-butyl-dimethyl-(2,2,2-trifluoroethoxy)silane?
The InChIKey is SXTLHVZNGHLKBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17F3OSi/c1-7(2,3)13(4,5)12-6-8(9,10)11/h6H2,1-5H3.
What are the key properties of tert-butyl-dimethyl-(2,2,2-trifluoroethoxy)silane?
tert-butyl-dimethyl-(2,2,2-trifluoroethoxy)silane has a molecular weight of 214.30 g/mol, XLogP of 3.57, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-(2,2,2-trifluoroethoxy)silane is sourced from PubChem (CID 91697408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).