C9H17F5OSi — CID 91697432
tert-butyl-dimethyl-(2,2,3,3,3-pentafluoropropoxy)silane (PubChem CID 91697432) has the molecular formula C9H17F5OSi and a molecular weight of 264.31 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2,2,3,3,3-pentafluoropropoxy)silane.
| Compound Name | tert-butyl-dimethyl-(2,2,3,3,3-pentafluoropropoxy)silane |
|---|---|
| PubChem CID | 91697432 |
| Molecular Formula | C9H17F5OSi |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | tert-butyl-dimethyl-(2,2,3,3,3-pentafluoropropoxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H17F5OSi/c1-7(2,3)16(4,5)15-6-8(10,11)9(12,13)14/h6H2,1-5H3 |
| InChIKey | NNNVVQXYQANYKC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|