C12H17F7O4Si — CID 91697500
[2-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91697500) has the molecular formula C12H17F7O4Si and a molecular weight of 386.34 g/mol. Its IUPAC name is [2-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [2-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91697500 |
| Molecular Formula | C12H17F7O4Si |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | [2-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)COC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H17F7O4Si/c1-9(2,3)24(4,5)23-7(20)6-22-8(21)10(13,14)11(15,16)12(17,18)19/h6H2,1-5H3 |
| InChIKey | UNFHNYQVAWWKTG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|