C12H13F7O4 — CID 91697668
methyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)cyclohexane-1-carboxylate (PubChem CID 91697668) has the molecular formula C12H13F7O4 and a molecular weight of 354.22 g/mol. Its IUPAC name is methyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)cyclohexane-1-carboxylate.
| Compound Name | methyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 91697668 |
| Molecular Formula | C12H13F7O4 |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | methyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H13F7O4/c1-22-8(20)6-2-4-7(5-3-6)23-9(21)10(13,14)11(15,16)12(17,18)19/h6-7H,2-5H2,1H3 |
| InChIKey | VNGACPUUDSJGNR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|