C11H13F5O4 — CID 91697669
methyl 4-(2,2,3,3,3-pentafluoropropanoyloxy)cyclohexane-1-carboxylate (PubChem CID 91697669) has the molecular formula C11H13F5O4 and a molecular weight of 304.21 g/mol. Its IUPAC name is methyl 4-(2,2,3,3,3-pentafluoropropanoyloxy)cyclohexane-1-carboxylate.
| Compound Name | methyl 4-(2,2,3,3,3-pentafluoropropanoyloxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 91697669 |
| Molecular Formula | C11H13F5O4 |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | methyl 4-(2,2,3,3,3-pentafluoropropanoyloxy)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(OC(=O)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H13F5O4/c1-19-8(17)6-2-4-7(5-3-6)20-9(18)10(12,13)11(14,15)16/h6-7H,2-5H2,1H3 |
| InChIKey | IWZYRQOEAXJKJO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|