C17H22F8O4 — CID 91697678
1-O-(2-cyclohexylethyl) 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate (PubChem CID 91697678) has the molecular formula C17H22F8O4 and a molecular weight of 442.34 g/mol. Its IUPAC name is 1-O-(2-cyclohexylethyl) 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate.
| Compound Name | 1-O-(2-cyclohexylethyl) 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate |
|---|---|
| PubChem CID | 91697678 |
| Molecular Formula | C17H22F8O4 |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-O-(2-cyclohexylethyl) 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate |
| SMILES | O=C(CCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)OCCC1CCCCC1 |
| InChI | InChI=1S/C17H22F8O4/c18-14(19)16(22,23)17(24,25)15(20,21)10-29-13(27)7-6-12(26)28-9-8-11-4-2-1-3-5-11/h11,14H,1-10H2 |
| InChIKey | QJTKQNWQAAGEDL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|