C11H13F7O2 — CID 91697692
(1-methylcyclohexyl) 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91697692) has the molecular formula C11H13F7O2 and a molecular weight of 310.21 g/mol. Its IUPAC name is (1-methylcyclohexyl) 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | (1-methylcyclohexyl) 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91697692 |
| Molecular Formula | C11H13F7O2 |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | (1-methylcyclohexyl) 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CC1(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C11H13F7O2/c1-8(5-3-2-4-6-8)20-7(19)9(12,13)10(14,15)11(16,17)18/h2-6H2,1H3 |
| InChIKey | KQMFUMNYSRKOTO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|