About 4-[[(E)-2-methylbut-2-enoyl]amino]butyl (E)-2-methylbut-2-enoate
4-[[(E)-2-methylbut-2-enoyl]amino]butyl (E)-2-methylbut-2-enoate (PubChem CID 91698169) has the molecular formula C14H23NO3
and a molecular weight of 253.34 g/mol. Its IUPAC name is 4-[[(E)-2-methylbut-2-enoyl]amino]butyl (E)-2-methylbut-2-enoate.
Molecular Properties
| Compound Name | 4-[[(E)-2-methylbut-2-enoyl]amino]butyl (E)-2-methylbut-2-enoate |
| PubChem CID | 91698169 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 4-[[(E)-2-methylbut-2-enoyl]amino]butyl (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)NCCCCOC(=O)/C(C)=C/C |
| InChI | InChI=1S/C14H23NO3/c1-5-11(3)13(16)15-9-7-8-10-18-14(17)12(4)6-2/h5-6H,7-10H2,1-4H3,(H,15,16)/b11-5+,12-6+ |
| InChIKey | OMMYLLDWKUNBAJ-YDWXAUTNSA-N |
| XLogP | 2.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(E)-2-methylbut-2-enoyl]amino]butyl (E)-2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(E)-2-methylbut-2-enoyl]amino]butyl (E)-2-methylbut-2-enoate?
The IUPAC name of 4-[[(E)-2-methylbut-2-enoyl]amino]butyl (E)-2-methylbut-2-enoate (CID 91698169) is 4-[[(E)-2-methylbut-2-enoyl]amino]butyl (E)-2-methylbut-2-enoate.
What is the SMILES notation for 4-[[(E)-2-methylbut-2-enoyl]amino]butyl (E)-2-methylbut-2-enoate?
The canonical SMILES for 4-[[(E)-2-methylbut-2-enoyl]amino]butyl (E)-2-methylbut-2-enoate is C/C=C(\C)C(=O)NCCCCOC(=O)/C(C)=C/C.
What is the InChIKey of 4-[[(E)-2-methylbut-2-enoyl]amino]butyl (E)-2-methylbut-2-enoate?
The InChIKey is OMMYLLDWKUNBAJ-YDWXAUTNSA-N. The full InChI is InChI=1S/C14H23NO3/c1-5-11(3)13(16)15-9-7-8-10-18-14(17)12(4)6-2/h5-6H,7-10H2,1-4H3,(H,15,16)/b11-5+,12-6+.
What are the key properties of 4-[[(E)-2-methylbut-2-enoyl]amino]butyl (E)-2-methylbut-2-enoate?
4-[[(E)-2-methylbut-2-enoyl]amino]butyl (E)-2-methylbut-2-enoate has a molecular weight of 253.34 g/mol, XLogP of 2.36, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(E)-2-methylbut-2-enoyl]amino]butyl (E)-2-methylbut-2-enoate is sourced from PubChem (CID 91698169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).