C19H30O2 — CID 91698171
[(E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl] (E)-2-methylbut-2-enoate (PubChem CID 91698171) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is [(E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 91698171 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | [(E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OC(C)/C(C)=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C19H30O2/c1-8-13(2)18(20)21-16(5)15(4)12-17-14(3)10-9-11-19(17,6)7/h8,12,16H,9-11H2,1-7H3/b13-8+,15-12+ |
| InChIKey | KPRKGDYBUQYSOZ-MKRNSSSCSA-N |
| XLogP | 5.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|