C17H36O2Si — CID 91698411
butoxy-(3,7-dimethyloctoxy)-ethenyl-methylsilane (PubChem CID 91698411) has the molecular formula C17H36O2Si and a molecular weight of 300.56 g/mol. Its IUPAC name is butoxy-(3,7-dimethyloctoxy)-ethenyl-methylsilane.
| Compound Name | butoxy-(3,7-dimethyloctoxy)-ethenyl-methylsilane |
|---|---|
| PubChem CID | 91698411 |
| Molecular Formula | C17H36O2Si |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | butoxy-(3,7-dimethyloctoxy)-ethenyl-methylsilane |
| SMILES | C=C[Si](C)(OCCCC)OCCC(C)CCCC(C)C |
| InChI | InChI=1S/C17H36O2Si/c1-7-9-14-18-20(6,8-2)19-15-13-17(5)12-10-11-16(3)4/h8,16-17H,2,7,9-15H2,1,3-6H3 |
| InChIKey | OTBWAQCJKVOYCL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|