C17H31NO2 — CID 91698501
(3Z)-3-(5-hydroxy-2-methylhexylidene)-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol (PubChem CID 91698501) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is (3Z)-3-(5-hydroxy-2-methylhexylidene)-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol.
| Compound Name | (3Z)-3-(5-hydroxy-2-methylhexylidene)-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol |
|---|---|
| PubChem CID | 91698501 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | (3Z)-3-(5-hydroxy-2-methylhexylidene)-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol |
| SMILES | CC(O)CCC(C)/C=C1\CN2CCCCC2C(C)(O)C1 |
| InChI | InChI=1S/C17H31NO2/c1-13(7-8-14(2)19)10-15-11-17(3,20)16-6-4-5-9-18(16)12-15/h10,13-14,16,19-20H,4-9,11-12H2,1-3H3/b15-10- |
| InChIKey | WZXRCUHDCBDHHT-GDNBJRDFSA-N |
| XLogP | 2.72 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|