About 2-(diethylamino)ethyl 2-acetyloxyacetate
2-(diethylamino)ethyl 2-acetyloxyacetate (PubChem CID 91698983) has the molecular formula C10H19NO4
and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-acetyloxyacetate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 2-acetyloxyacetate |
| PubChem CID | 91698983 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-(diethylamino)ethyl 2-acetyloxyacetate |
| SMILES | CCN(CC)CCOC(=O)COC(C)=O |
| InChI | InChI=1S/C10H19NO4/c1-4-11(5-2)6-7-14-10(13)8-15-9(3)12/h4-8H2,1-3H3 |
| InChIKey | WQXAAHMXTCIDLY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(diethylamino)ethyl 2-acetyloxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 2-acetyloxyacetate?
The IUPAC name of 2-(diethylamino)ethyl 2-acetyloxyacetate (CID 91698983) is 2-(diethylamino)ethyl 2-acetyloxyacetate.
What is the SMILES notation for 2-(diethylamino)ethyl 2-acetyloxyacetate?
The canonical SMILES for 2-(diethylamino)ethyl 2-acetyloxyacetate is CCN(CC)CCOC(=O)COC(C)=O.
What is the InChIKey of 2-(diethylamino)ethyl 2-acetyloxyacetate?
The InChIKey is WQXAAHMXTCIDLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO4/c1-4-11(5-2)6-7-14-10(13)8-15-9(3)12/h4-8H2,1-3H3.
What are the key properties of 2-(diethylamino)ethyl 2-acetyloxyacetate?
2-(diethylamino)ethyl 2-acetyloxyacetate has a molecular weight of 217.26 g/mol, XLogP of 0.43, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 2-acetyloxyacetate is sourced from PubChem (CID 91698983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).