C19H31F5N2O4 — CID 91698996
butyl 4-methyl-2-[[4-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)pentanoyl]amino]pentanoate (PubChem CID 91698996) has the molecular formula C19H31F5N2O4 and a molecular weight of 446.46 g/mol. Its IUPAC name is butyl 4-methyl-2-[[4-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)pentanoyl]amino]pentanoate.
| Compound Name | butyl 4-methyl-2-[[4-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)pentanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 91698996 |
| Molecular Formula | C19H31F5N2O4 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | butyl 4-methyl-2-[[4-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)pentanoyl]amino]pentanoate |
| SMILES | CCCCOC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H31F5N2O4/c1-6-7-8-30-16(28)14(10-12(4)5)25-15(27)13(9-11(2)3)26-17(29)18(20,21)19(22,23)24/h11-14H,6-10H2,1-5H3,(H,25,27)(H,26,29) |
| InChIKey | DITBBMNJHXBORU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|