C9H16O5 — CID 91699158
(1S,2R,3S,4S,5R)-2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 91699158) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is (1S,2R,3S,4S,5R)-2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane.
| Compound Name | (1S,2R,3S,4S,5R)-2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 91699158 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (1S,2R,3S,4S,5R)-2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | CO[C@@H]1[C@H](OC)[C@@H]2OC[C@H](O2)[C@H]1OC |
| InChI | InChI=1S/C9H16O5/c1-10-6-5-4-13-9(14-5)8(12-3)7(6)11-2/h5-9H,4H2,1-3H3/t5-,6+,7-,8-,9+/m0/s1 |
| InChIKey | ZZSLTIGBKYUBSG-QKAWAISNSA-N |
| XLogP | -0.21 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |