C10H19FO5 — CID 91699163
(2R,3R,4S,5S,6R)-2-(fluoromethyl)-3,4,5,6-tetramethoxyoxane (PubChem CID 91699163) has the molecular formula C10H19FO5 and a molecular weight of 238.25 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-(fluoromethyl)-3,4,5,6-tetramethoxyoxane.
| Compound Name | (2R,3R,4S,5S,6R)-2-(fluoromethyl)-3,4,5,6-tetramethoxyoxane |
|---|---|
| PubChem CID | 91699163 |
| Molecular Formula | C10H19FO5 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-(fluoromethyl)-3,4,5,6-tetramethoxyoxane |
| SMILES | CO[C@@H]1O[C@@H](CF)[C@H](OC)[C@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C10H19FO5/c1-12-7-6(5-11)16-10(15-4)9(14-3)8(7)13-2/h6-10H,5H2,1-4H3/t6-,7-,8-,9-,10+/m0/s1 |
| InChIKey | NIGJZKSNSAZYMR-BQHMLIOBSA-N |
| XLogP | 0.37 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |