About 10-chlorodecyl ethyl carbonate
10-chlorodecyl ethyl carbonate (PubChem CID 91699398) has the molecular formula C13H25ClO3
and a molecular weight of 264.79 g/mol. Its IUPAC name is 10-chlorodecyl ethyl carbonate.
Molecular Properties
| Compound Name | 10-chlorodecyl ethyl carbonate |
| PubChem CID | 91699398 |
| Molecular Formula | C13H25ClO3 |
| Molecular Weight | 264.79 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 10-chlorodecyl ethyl carbonate |
| SMILES | CCOC(=O)OCCCCCCCCCCCl |
| InChI | InChI=1S/C13H25ClO3/c1-2-16-13(15)17-12-10-8-6-4-3-5-7-9-11-14/h2-12H2,1H3 |
| InChIKey | RCJVEQGSPNMRBB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.79 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 10-chlorodecyl ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-chlorodecyl ethyl carbonate?
The IUPAC name of 10-chlorodecyl ethyl carbonate (CID 91699398) is 10-chlorodecyl ethyl carbonate.
What is the SMILES notation for 10-chlorodecyl ethyl carbonate?
The canonical SMILES for 10-chlorodecyl ethyl carbonate is CCOC(=O)OCCCCCCCCCCCl.
What is the InChIKey of 10-chlorodecyl ethyl carbonate?
The InChIKey is RCJVEQGSPNMRBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25ClO3/c1-2-16-13(15)17-12-10-8-6-4-3-5-7-9-11-14/h2-12H2,1H3.
What are the key properties of 10-chlorodecyl ethyl carbonate?
10-chlorodecyl ethyl carbonate has a molecular weight of 264.79 g/mol, XLogP of 4.52, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-chlorodecyl ethyl carbonate is sourced from PubChem (CID 91699398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).