About N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N'-benzylmethanimidamide
N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N'-benzylmethanimidamide (PubChem CID 91699453) has the molecular formula C16H16N6
and a molecular weight of 292.35 g/mol. Its IUPAC name is N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N'-benzylmethanimidamide.
Molecular Properties
| Compound Name | N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N'-benzylmethanimidamide |
| PubChem CID | 91699453 |
| Molecular Formula | C16H16N6 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N'-benzylmethanimidamide |
| SMILES | Nc1nc(N/C=N/Cc2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C16H16N6/c17-15-20-16(21-22(15)14-9-5-2-6-10-14)19-12-18-11-13-7-3-1-4-8-13/h1-10,12H,11H2,(H3,17,18,19,20,21) |
| InChIKey | DANASBYUAWUUAP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N'-benzylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N'-benzylmethanimidamide?
The IUPAC name of N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N'-benzylmethanimidamide (CID 91699453) is N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N'-benzylmethanimidamide.
What is the SMILES notation for N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N'-benzylmethanimidamide?
The canonical SMILES for N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N'-benzylmethanimidamide is Nc1nc(N/C=N/Cc2ccccc2)nn1-c1ccccc1.
What is the InChIKey of N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N'-benzylmethanimidamide?
The InChIKey is DANASBYUAWUUAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N6/c17-15-20-16(21-22(15)14-9-5-2-6-10-14)19-12-18-11-13-7-3-1-4-8-13/h1-10,12H,11H2,(H3,17,18,19,20,21).
What are the key properties of N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N'-benzylmethanimidamide?
N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N'-benzylmethanimidamide has a molecular weight of 292.35 g/mol, XLogP of 2.49, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N'-benzylmethanimidamide is sourced from PubChem (CID 91699453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).