C22H28BrF3O2Si — CID 91699488
(3-bromo-1,1,1-trifluoropropan-2-yl)oxy-heptoxy-diphenylsilane (PubChem CID 91699488) has the molecular formula C22H28BrF3O2Si and a molecular weight of 489.45 g/mol. Its IUPAC name is (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-heptoxy-diphenylsilane.
| Compound Name | (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-heptoxy-diphenylsilane |
|---|---|
| PubChem CID | 91699488 |
| Molecular Formula | C22H28BrF3O2Si |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-heptoxy-diphenylsilane |
| SMILES | CCCCCCCO[Si](OC(CBr)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28BrF3O2Si/c1-2-3-4-5-12-17-27-29(19-13-8-6-9-14-19,20-15-10-7-11-16-20)28-21(18-23)22(24,25)26/h6-11,13-16,21H,2-5,12,17-18H2,1H3 |
| InChIKey | LQEJEGMYYCHEJM-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|