About pentan-2-yl (E)-4-[benzyl(2-phenylethyl)amino]-4-oxobut-2-enoate
pentan-2-yl (E)-4-[benzyl(2-phenylethyl)amino]-4-oxobut-2-enoate (PubChem CID 91699604) has the molecular formula C24H29NO3
and a molecular weight of 379.50 g/mol. Its IUPAC name is pentan-2-yl (E)-4-[benzyl(2-phenylethyl)amino]-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | pentan-2-yl (E)-4-[benzyl(2-phenylethyl)amino]-4-oxobut-2-enoate |
| PubChem CID | 91699604 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | pentan-2-yl (E)-4-[benzyl(2-phenylethyl)amino]-4-oxobut-2-enoate |
| SMILES | CCCC(C)OC(=O)/C=C/C(=O)N(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H29NO3/c1-3-10-20(2)28-24(27)16-15-23(26)25(19-22-13-8-5-9-14-22)18-17-21-11-6-4-7-12-21/h4-9,11-16,20H,3,10,17-19H2,1-2H3/b16-15+ |
| InChIKey | XFKHNKCVSDNYAB-FOCLMDBBSA-N |
| XLogP | 4.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze pentan-2-yl (E)-4-[benzyl(2-phenylethyl)amino]-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-yl (E)-4-[benzyl(2-phenylethyl)amino]-4-oxobut-2-enoate?
The IUPAC name of pentan-2-yl (E)-4-[benzyl(2-phenylethyl)amino]-4-oxobut-2-enoate (CID 91699604) is pentan-2-yl (E)-4-[benzyl(2-phenylethyl)amino]-4-oxobut-2-enoate.
What is the SMILES notation for pentan-2-yl (E)-4-[benzyl(2-phenylethyl)amino]-4-oxobut-2-enoate?
The canonical SMILES for pentan-2-yl (E)-4-[benzyl(2-phenylethyl)amino]-4-oxobut-2-enoate is CCCC(C)OC(=O)/C=C/C(=O)N(CCc1ccccc1)Cc1ccccc1.
What is the InChIKey of pentan-2-yl (E)-4-[benzyl(2-phenylethyl)amino]-4-oxobut-2-enoate?
The InChIKey is XFKHNKCVSDNYAB-FOCLMDBBSA-N. The full InChI is InChI=1S/C24H29NO3/c1-3-10-20(2)28-24(27)16-15-23(26)25(19-22-13-8-5-9-14-22)18-17-21-11-6-4-7-12-21/h4-9,11-16,20H,3,10,17-19H2,1-2H3/b16-15+.
What are the key properties of pentan-2-yl (E)-4-[benzyl(2-phenylethyl)amino]-4-oxobut-2-enoate?
pentan-2-yl (E)-4-[benzyl(2-phenylethyl)amino]-4-oxobut-2-enoate has a molecular weight of 379.50 g/mol, XLogP of 4.55, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-yl (E)-4-[benzyl(2-phenylethyl)amino]-4-oxobut-2-enoate is sourced from PubChem (CID 91699604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).