About bis[(3-bromo-1,1,1-trifluoropropan-2-yl)oxy]-diphenylsilane
bis[(3-bromo-1,1,1-trifluoropropan-2-yl)oxy]-diphenylsilane (PubChem CID 91699655) has the molecular formula C18H16Br2F6O2Si
and a molecular weight of 566.21 g/mol. Its IUPAC name is bis[(3-bromo-1,1,1-trifluoropropan-2-yl)oxy]-diphenylsilane.
Molecular Properties
| Compound Name | bis[(3-bromo-1,1,1-trifluoropropan-2-yl)oxy]-diphenylsilane |
| PubChem CID | 91699655 |
| Molecular Formula | C18H16Br2F6O2Si |
| Molecular Weight | 566.21 g/mol |
| Exact Mass | 563.92 |
| IUPAC Name | bis[(3-bromo-1,1,1-trifluoropropan-2-yl)oxy]-diphenylsilane |
| SMILES | FC(F)(F)C(CBr)O[Si](OC(CBr)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16Br2F6O2Si/c19-11-15(17(21,22)23)27-29(13-7-3-1-4-8-13,14-9-5-2-6-10-14)28-16(12-20)18(24,25)26/h1-10,15-16H,11-12H2 |
| InChIKey | SLDCQKYVVXSIEH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 566.21 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis[(3-bromo-1,1,1-trifluoropropan-2-yl)oxy]-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(3-bromo-1,1,1-trifluoropropan-2-yl)oxy]-diphenylsilane?
The IUPAC name of bis[(3-bromo-1,1,1-trifluoropropan-2-yl)oxy]-diphenylsilane (CID 91699655) is bis[(3-bromo-1,1,1-trifluoropropan-2-yl)oxy]-diphenylsilane.
What is the SMILES notation for bis[(3-bromo-1,1,1-trifluoropropan-2-yl)oxy]-diphenylsilane?
The canonical SMILES for bis[(3-bromo-1,1,1-trifluoropropan-2-yl)oxy]-diphenylsilane is FC(F)(F)C(CBr)O[Si](OC(CBr)C(F)(F)F)(c1ccccc1)c1ccccc1.
What is the InChIKey of bis[(3-bromo-1,1,1-trifluoropropan-2-yl)oxy]-diphenylsilane?
The InChIKey is SLDCQKYVVXSIEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16Br2F6O2Si/c19-11-15(17(21,22)23)27-29(13-7-3-1-4-8-13,14-9-5-2-6-10-14)28-16(12-20)18(24,25)26/h1-10,15-16H,11-12H2.
What are the key properties of bis[(3-bromo-1,1,1-trifluoropropan-2-yl)oxy]-diphenylsilane?
bis[(3-bromo-1,1,1-trifluoropropan-2-yl)oxy]-diphenylsilane has a molecular weight of 566.21 g/mol, XLogP of 4.93, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(3-bromo-1,1,1-trifluoropropan-2-yl)oxy]-diphenylsilane is sourced from PubChem (CID 91699655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).