C18H22F5NO3 — CID 91699662
4-methylpentyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate (PubChem CID 91699662) has the molecular formula C18H22F5NO3 and a molecular weight of 395.37 g/mol. Its IUPAC name is 4-methylpentyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate.
| Compound Name | 4-methylpentyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 91699662 |
| Molecular Formula | C18H22F5NO3 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 4-methylpentyl 2-(2,2,3,3,3-pentafluoropropanoylamino)-3-phenylpropanoate |
| SMILES | CC(C)CCCOC(=O)C(Cc1ccccc1)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H22F5NO3/c1-12(2)7-6-10-27-15(25)14(11-13-8-4-3-5-9-13)24-16(26)17(19,20)18(21,22)23/h3-5,8-9,12,14H,6-7,10-11H2,1-2H3,(H,24,26) |
| InChIKey | JQUMOOLSHNOQGO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|