C20H29NO4 — CID 91699712
heptyl 2-(phenylmethoxycarbonylamino)pent-4-enoate (PubChem CID 91699712) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is heptyl 2-(phenylmethoxycarbonylamino)pent-4-enoate.
| Compound Name | heptyl 2-(phenylmethoxycarbonylamino)pent-4-enoate |
|---|---|
| PubChem CID | 91699712 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | heptyl 2-(phenylmethoxycarbonylamino)pent-4-enoate |
| SMILES | C=CCC(NC(=O)OCc1ccccc1)C(=O)OCCCCCCC |
| InChI | InChI=1S/C20H29NO4/c1-3-5-6-7-11-15-24-19(22)18(12-4-2)21-20(23)25-16-17-13-9-8-10-14-17/h4,8-10,13-14,18H,2-3,5-7,11-12,15-16H2,1H3,(H,21,23) |
| InChIKey | HIBPOMSDRKGKMU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|