About (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-hexoxy-diphenylsilane
(3-bromo-1,1,1-trifluoropropan-2-yl)oxy-hexoxy-diphenylsilane (PubChem CID 91699829) has the molecular formula C21H26BrF3O2Si
and a molecular weight of 475.42 g/mol. Its IUPAC name is (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-hexoxy-diphenylsilane.
Molecular Properties
| Compound Name | (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-hexoxy-diphenylsilane |
| PubChem CID | 91699829 |
| Molecular Formula | C21H26BrF3O2Si |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-hexoxy-diphenylsilane |
| SMILES | CCCCCCO[Si](OC(CBr)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26BrF3O2Si/c1-2-3-4-11-16-26-28(18-12-7-5-8-13-18,19-14-9-6-10-15-19)27-20(17-22)21(23,24)25/h5-10,12-15,20H,2-4,11,16-17H2,1H3 |
| InChIKey | VRVTYLZGKQAEGQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-hexoxy-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-hexoxy-diphenylsilane?
The IUPAC name of (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-hexoxy-diphenylsilane (CID 91699829) is (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-hexoxy-diphenylsilane.
What is the SMILES notation for (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-hexoxy-diphenylsilane?
The canonical SMILES for (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-hexoxy-diphenylsilane is CCCCCCO[Si](OC(CBr)C(F)(F)F)(c1ccccc1)c1ccccc1.
What is the InChIKey of (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-hexoxy-diphenylsilane?
The InChIKey is VRVTYLZGKQAEGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26BrF3O2Si/c1-2-3-4-11-16-26-28(18-12-7-5-8-13-18,19-14-9-6-10-15-19)27-20(17-22)21(23,24)25/h5-10,12-15,20H,2-4,11,16-17H2,1H3.
What are the key properties of (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-hexoxy-diphenylsilane?
(3-bromo-1,1,1-trifluoropropan-2-yl)oxy-hexoxy-diphenylsilane has a molecular weight of 475.42 g/mol, XLogP of 5.18, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-hexoxy-diphenylsilane is sourced from PubChem (CID 91699829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).