C23H22N2O4 — CID 91699856
benzyl N-[1-(3-hydroxyanilino)-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 91699856) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is benzyl N-[1-(3-hydroxyanilino)-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[1-(3-hydroxyanilino)-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 91699856 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | benzyl N-[1-(3-hydroxyanilino)-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)Nc1cccc(O)c1)OCc1ccccc1 |
| InChI | InChI=1S/C23H22N2O4/c26-20-13-7-12-19(15-20)24-22(27)21(14-17-8-3-1-4-9-17)25-23(28)29-16-18-10-5-2-6-11-18/h1-13,15,21,26H,14,16H2,(H,24,27)(H,25,28) |
| InChIKey | WGKLKRFVGYLTBU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |