About triphenylene
triphenylene (PubChem CID 9170) has the molecular formula C18H12
and a molecular weight of 228.29 g/mol. Its IUPAC name is triphenylene.
Molecular Properties
| Compound Name | triphenylene |
| PubChem CID | 9170 |
| Molecular Formula | C18H12 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | triphenylene |
| SMILES | c1ccc2c(c1)c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C18H12/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18/h1-12H |
| InChIKey | SLGBZMMZGDRARJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze triphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenylene?
The IUPAC name of triphenylene (CID 9170) is triphenylene.
What is the SMILES notation for triphenylene?
The canonical SMILES for triphenylene is c1ccc2c(c1)c1ccccc1c1ccccc21.
What is the InChIKey of triphenylene?
The InChIKey is SLGBZMMZGDRARJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18/h1-12H.
What are the key properties of triphenylene?
triphenylene has a molecular weight of 228.29 g/mol, XLogP of 5.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triphenylene is sourced from PubChem (CID 9170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).