C13H22F3NO3Si2 — CID 91700294
[dimethyl(pyridin-3-ylmethoxy)silyl]oxy-dimethyl-(1,1,1-trifluoropropan-2-yloxy)silane (PubChem CID 91700294) has the molecular formula C13H22F3NO3Si2 and a molecular weight of 353.49 g/mol. Its IUPAC name is [dimethyl(pyridin-3-ylmethoxy)silyl]oxy-dimethyl-(1,1,1-trifluoropropan-2-yloxy)silane.
| Compound Name | [dimethyl(pyridin-3-ylmethoxy)silyl]oxy-dimethyl-(1,1,1-trifluoropropan-2-yloxy)silane |
|---|---|
| PubChem CID | 91700294 |
| Molecular Formula | C13H22F3NO3Si2 |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | [dimethyl(pyridin-3-ylmethoxy)silyl]oxy-dimethyl-(1,1,1-trifluoropropan-2-yloxy)silane |
| SMILES | CC(O[Si](C)(C)O[Si](C)(C)OCc1cccnc1)C(F)(F)F |
| InChI | InChI=1S/C13H22F3NO3Si2/c1-11(13(14,15)16)19-22(4,5)20-21(2,3)18-10-12-7-6-8-17-9-12/h6-9,11H,10H2,1-5H3 |
| InChIKey | POSXKISYGSFHBH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|