C17H20F8O4 — CID 91700440
1-O-(cyclohex-3-en-1-ylmethyl) 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate (PubChem CID 91700440) has the molecular formula C17H20F8O4 and a molecular weight of 440.33 g/mol. Its IUPAC name is 1-O-(cyclohex-3-en-1-ylmethyl) 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate.
| Compound Name | 1-O-(cyclohex-3-en-1-ylmethyl) 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
|---|---|
| PubChem CID | 91700440 |
| Molecular Formula | C17H20F8O4 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 1-O-(cyclohex-3-en-1-ylmethyl) 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
| SMILES | O=C(CCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)OCC1CC=CCC1 |
| InChI | InChI=1S/C17H20F8O4/c18-14(19)16(22,23)17(24,25)15(20,21)10-29-13(27)8-4-7-12(26)28-9-11-5-2-1-3-6-11/h1-2,11,14H,3-10H2 |
| InChIKey | ZZTNROWWVMEVTL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|