About 1-O-[(2-chlorocyclohexyl)methyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate
1-O-[(2-chlorocyclohexyl)methyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate (PubChem CID 91700698) has the molecular formula C14H20ClF3O4
and a molecular weight of 344.76 g/mol. Its IUPAC name is 1-O-[(2-chlorocyclohexyl)methyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate.
Molecular Properties
| Compound Name | 1-O-[(2-chlorocyclohexyl)methyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate |
| PubChem CID | 91700698 |
| Molecular Formula | C14H20ClF3O4 |
| Molecular Weight | 344.76 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 1-O-[(2-chlorocyclohexyl)methyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate |
| SMILES | CC(OC(=O)CCC(=O)OCC1CCCCC1Cl)C(F)(F)F |
| InChI | InChI=1S/C14H20ClF3O4/c1-9(14(16,17)18)22-13(20)7-6-12(19)21-8-10-4-2-3-5-11(10)15/h9-11H,2-8H2,1H3 |
| InChIKey | IYZXMVMCVSTQII-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[(2-chlorocyclohexyl)methyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[(2-chlorocyclohexyl)methyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate?
The IUPAC name of 1-O-[(2-chlorocyclohexyl)methyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate (CID 91700698) is 1-O-[(2-chlorocyclohexyl)methyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate.
What is the SMILES notation for 1-O-[(2-chlorocyclohexyl)methyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate?
The canonical SMILES for 1-O-[(2-chlorocyclohexyl)methyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate is CC(OC(=O)CCC(=O)OCC1CCCCC1Cl)C(F)(F)F.
What is the InChIKey of 1-O-[(2-chlorocyclohexyl)methyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate?
The InChIKey is IYZXMVMCVSTQII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClF3O4/c1-9(14(16,17)18)22-13(20)7-6-12(19)21-8-10-4-2-3-5-11(10)15/h9-11H,2-8H2,1H3.
What are the key properties of 1-O-[(2-chlorocyclohexyl)methyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate?
1-O-[(2-chlorocyclohexyl)methyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate has a molecular weight of 344.76 g/mol, XLogP of 3.60, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[(2-chlorocyclohexyl)methyl] 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate is sourced from PubChem (CID 91700698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).