C25H38O4 — CID 91700807
4-O-(cyclohexylmethyl) 1-O-decyl benzene-1,4-dicarboxylate (PubChem CID 91700807) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is 4-O-(cyclohexylmethyl) 1-O-decyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-(cyclohexylmethyl) 1-O-decyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91700807 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 4-O-(cyclohexylmethyl) 1-O-decyl benzene-1,4-dicarboxylate |
| SMILES | CCCCCCCCCCOC(=O)c1ccc(C(=O)OCC2CCCCC2)cc1 |
| InChI | InChI=1S/C25H38O4/c1-2-3-4-5-6-7-8-12-19-28-24(26)22-15-17-23(18-16-22)25(27)29-20-21-13-10-9-11-14-21/h15-18,21H,2-14,19-20H2,1H3 |
| InChIKey | IZRMIPIDEFSERF-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|