C18H28O4 — CID 91700866
1-O-(cyclohexylmethyl) 4-O-hepta-1,6-dien-4-yl butanedioate (PubChem CID 91700866) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-O-(cyclohexylmethyl) 4-O-hepta-1,6-dien-4-yl butanedioate.
| Compound Name | 1-O-(cyclohexylmethyl) 4-O-hepta-1,6-dien-4-yl butanedioate |
|---|---|
| PubChem CID | 91700866 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 1-O-(cyclohexylmethyl) 4-O-hepta-1,6-dien-4-yl butanedioate |
| SMILES | C=CCC(CC=C)OC(=O)CCC(=O)OCC1CCCCC1 |
| InChI | InChI=1S/C18H28O4/c1-3-8-16(9-4-2)22-18(20)13-12-17(19)21-14-15-10-6-5-7-11-15/h3-4,15-16H,1-2,5-14H2 |
| InChIKey | HRUVINYFRULCNB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|