About (2-fluorophenyl) 2-thiophen-2-ylacetate
(2-fluorophenyl) 2-thiophen-2-ylacetate (PubChem CID 91700999) has the molecular formula C12H9FO2S
and a molecular weight of 236.27 g/mol. Its IUPAC name is (2-fluorophenyl) 2-thiophen-2-ylacetate.
Molecular Properties
| Compound Name | (2-fluorophenyl) 2-thiophen-2-ylacetate |
| PubChem CID | 91700999 |
| Molecular Formula | C12H9FO2S |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | (2-fluorophenyl) 2-thiophen-2-ylacetate |
| SMILES | O=C(Cc1cccs1)Oc1ccccc1F |
| InChI | InChI=1S/C12H9FO2S/c13-10-5-1-2-6-11(10)15-12(14)8-9-4-3-7-16-9/h1-7H,8H2 |
| InChIKey | LYFGABKAHFQMOK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-fluorophenyl) 2-thiophen-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl) 2-thiophen-2-ylacetate?
The IUPAC name of (2-fluorophenyl) 2-thiophen-2-ylacetate (CID 91700999) is (2-fluorophenyl) 2-thiophen-2-ylacetate.
What is the SMILES notation for (2-fluorophenyl) 2-thiophen-2-ylacetate?
The canonical SMILES for (2-fluorophenyl) 2-thiophen-2-ylacetate is O=C(Cc1cccs1)Oc1ccccc1F.
What is the InChIKey of (2-fluorophenyl) 2-thiophen-2-ylacetate?
The InChIKey is LYFGABKAHFQMOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FO2S/c13-10-5-1-2-6-11(10)15-12(14)8-9-4-3-7-16-9/h1-7H,8H2.
What are the key properties of (2-fluorophenyl) 2-thiophen-2-ylacetate?
(2-fluorophenyl) 2-thiophen-2-ylacetate has a molecular weight of 236.27 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl) 2-thiophen-2-ylacetate is sourced from PubChem (CID 91700999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).