C12H18O3 — CID 91701202
(4aS,8aR)-spiro[1,3,4,4a,5,7,8,8a-octahydronaphthalene-6,2'-1,3-dioxolane]-2-one (PubChem CID 91701202) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (4aS,8aR)-spiro[1,3,4,4a,5,7,8,8a-octahydronaphthalene-6,2'-1,3-dioxolane]-2-one.
| Compound Name | (4aS,8aR)-spiro[1,3,4,4a,5,7,8,8a-octahydronaphthalene-6,2'-1,3-dioxolane]-2-one |
|---|---|
| PubChem CID | 91701202 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (4aS,8aR)-spiro[1,3,4,4a,5,7,8,8a-octahydronaphthalene-6,2'-1,3-dioxolane]-2-one |
| SMILES | O=C1CC[C@H]2CC3(CC[C@@H]2C1)OCCO3 |
| InChI | InChI=1S/C12H18O3/c13-11-2-1-10-8-12(14-5-6-15-12)4-3-9(10)7-11/h9-10H,1-8H2/t9-,10+/m1/s1 |
| InChIKey | YZNMYYFGVGLPOA-ZJUUUORDSA-N |
| XLogP | 1.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |