C9H14O2 — CID 91701281
(4aS,9aS)-3,4a,7,8,9,9a-hexahydro-2H-cyclohepta[b][1,4]dioxine (PubChem CID 91701281) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (4aS,9aS)-3,4a,7,8,9,9a-hexahydro-2H-cyclohepta[b][1,4]dioxine.
| Compound Name | (4aS,9aS)-3,4a,7,8,9,9a-hexahydro-2H-cyclohepta[b][1,4]dioxine |
|---|---|
| PubChem CID | 91701281 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (4aS,9aS)-3,4a,7,8,9,9a-hexahydro-2H-cyclohepta[b][1,4]dioxine |
| SMILES | C1=C[C@@H]2OCCO[C@H]2CCC1 |
| InChI | InChI=1S/C9H14O2/c1-2-4-8-9(5-3-1)11-7-6-10-8/h2,4,8-9H,1,3,5-7H2/t8-,9-/m0/s1 |
| InChIKey | GUPKEFUJDMLGBZ-IUCAKERBSA-N |
| XLogP | 1.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|