C15H25N3 — CID 9170136
(4R)-4-N,4-N-diethyl-7-N,7-N-dimethyl-1,2,3,4-tetrahydroisoquinoline-4,7-diamine (PubChem CID 9170136) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is (4R)-4-N,4-N-diethyl-7-N,7-N-dimethyl-1,2,3,4-tetrahydroisoquinoline-4,7-diamine.
| Compound Name | (4R)-4-N,4-N-diethyl-7-N,7-N-dimethyl-1,2,3,4-tetrahydroisoquinoline-4,7-diamine |
|---|---|
| PubChem CID | 9170136 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | (4R)-4-N,4-N-diethyl-7-N,7-N-dimethyl-1,2,3,4-tetrahydroisoquinoline-4,7-diamine |
| SMILES | CCN(CC)[C@H]1CNCc2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C15H25N3/c1-5-18(6-2)15-11-16-10-12-9-13(17(3)4)7-8-14(12)15/h7-9,15-16H,5-6,10-11H2,1-4H3/t15-/m0/s1 |
| InChIKey | KBVCQAHWVJJWAN-HNNXBMFYSA-N |
| XLogP | 2.24 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|