C22H42O3 — CID 91701499
4-[[(E)-hexadec-9-enoxy]methyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 91701499) has the molecular formula C22H42O3 and a molecular weight of 354.58 g/mol. Its IUPAC name is 4-[[(E)-hexadec-9-enoxy]methyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-[[(E)-hexadec-9-enoxy]methyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 91701499 |
| Molecular Formula | C22H42O3 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.31 |
| IUPAC Name | 4-[[(E)-hexadec-9-enoxy]methyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CCCCCC/C=C/CCCCCCCCOCC1COC(C)(C)O1 |
| InChI | InChI=1S/C22H42O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-19-21-20-24-22(2,3)25-21/h9-10,21H,4-8,11-20H2,1-3H3/b10-9+ |
| InChIKey | GUBGTFOWTBUJOY-MDZDMXLPSA-N |
| XLogP | 6.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|