About 4-O-[(E)-dec-4-enyl] 1-O-propyl butanedioate
4-O-[(E)-dec-4-enyl] 1-O-propyl butanedioate (PubChem CID 91701750) has the molecular formula C17H30O4
and a molecular weight of 298.42 g/mol. Its IUPAC name is 4-O-[(E)-dec-4-enyl] 1-O-propyl butanedioate.
Molecular Properties
| Compound Name | 4-O-[(E)-dec-4-enyl] 1-O-propyl butanedioate |
| PubChem CID | 91701750 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 4-O-[(E)-dec-4-enyl] 1-O-propyl butanedioate |
| SMILES | CCCCC/C=C/CCCOC(=O)CCC(=O)OCCC |
| InChI | InChI=1S/C17H30O4/c1-3-5-6-7-8-9-10-11-15-21-17(19)13-12-16(18)20-14-4-2/h8-9H,3-7,10-15H2,1-2H3/b9-8+ |
| InChIKey | MIDVIBRETGJKOZ-CMDGGOBGSA-N |
| XLogP | 4.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-O-[(E)-dec-4-enyl] 1-O-propyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[(E)-dec-4-enyl] 1-O-propyl butanedioate?
The IUPAC name of 4-O-[(E)-dec-4-enyl] 1-O-propyl butanedioate (CID 91701750) is 4-O-[(E)-dec-4-enyl] 1-O-propyl butanedioate.
What is the SMILES notation for 4-O-[(E)-dec-4-enyl] 1-O-propyl butanedioate?
The canonical SMILES for 4-O-[(E)-dec-4-enyl] 1-O-propyl butanedioate is CCCCC/C=C/CCCOC(=O)CCC(=O)OCCC.
What is the InChIKey of 4-O-[(E)-dec-4-enyl] 1-O-propyl butanedioate?
The InChIKey is MIDVIBRETGJKOZ-CMDGGOBGSA-N. The full InChI is InChI=1S/C17H30O4/c1-3-5-6-7-8-9-10-11-15-21-17(19)13-12-16(18)20-14-4-2/h8-9H,3-7,10-15H2,1-2H3/b9-8+.
What are the key properties of 4-O-[(E)-dec-4-enyl] 1-O-propyl butanedioate?
4-O-[(E)-dec-4-enyl] 1-O-propyl butanedioate has a molecular weight of 298.42 g/mol, XLogP of 4.18, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[(E)-dec-4-enyl] 1-O-propyl butanedioate is sourced from PubChem (CID 91701750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).