About 1-O-(2,2-dichloroethyl) 4-O-pent-4-en-2-yl butanedioate
1-O-(2,2-dichloroethyl) 4-O-pent-4-en-2-yl butanedioate (PubChem CID 91701798) has the molecular formula C11H16Cl2O4
and a molecular weight of 283.15 g/mol. Its IUPAC name is 1-O-(2,2-dichloroethyl) 4-O-pent-4-en-2-yl butanedioate.
Molecular Properties
| Compound Name | 1-O-(2,2-dichloroethyl) 4-O-pent-4-en-2-yl butanedioate |
| PubChem CID | 91701798 |
| Molecular Formula | C11H16Cl2O4 |
| Molecular Weight | 283.15 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 1-O-(2,2-dichloroethyl) 4-O-pent-4-en-2-yl butanedioate |
| SMILES | C=CCC(C)OC(=O)CCC(=O)OCC(Cl)Cl |
| InChI | InChI=1S/C11H16Cl2O4/c1-3-4-8(2)17-11(15)6-5-10(14)16-7-9(12)13/h3,8-9H,1,4-7H2,2H3 |
| InChIKey | HZWPFXIEUAKARC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.15 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(2,2-dichloroethyl) 4-O-pent-4-en-2-yl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(2,2-dichloroethyl) 4-O-pent-4-en-2-yl butanedioate?
The IUPAC name of 1-O-(2,2-dichloroethyl) 4-O-pent-4-en-2-yl butanedioate (CID 91701798) is 1-O-(2,2-dichloroethyl) 4-O-pent-4-en-2-yl butanedioate.
What is the SMILES notation for 1-O-(2,2-dichloroethyl) 4-O-pent-4-en-2-yl butanedioate?
The canonical SMILES for 1-O-(2,2-dichloroethyl) 4-O-pent-4-en-2-yl butanedioate is C=CCC(C)OC(=O)CCC(=O)OCC(Cl)Cl.
What is the InChIKey of 1-O-(2,2-dichloroethyl) 4-O-pent-4-en-2-yl butanedioate?
The InChIKey is HZWPFXIEUAKARC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16Cl2O4/c1-3-4-8(2)17-11(15)6-5-10(14)16-7-9(12)13/h3,8-9H,1,4-7H2,2H3.
What are the key properties of 1-O-(2,2-dichloroethyl) 4-O-pent-4-en-2-yl butanedioate?
1-O-(2,2-dichloroethyl) 4-O-pent-4-en-2-yl butanedioate has a molecular weight of 283.15 g/mol, XLogP of 2.62, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(2,2-dichloroethyl) 4-O-pent-4-en-2-yl butanedioate is sourced from PubChem (CID 91701798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).