C16H15F5OSi — CID 91703256
dimethyl-[(2-methylphenyl)methoxy]-(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 91703256) has the molecular formula C16H15F5OSi and a molecular weight of 346.37 g/mol. Its IUPAC name is dimethyl-[(2-methylphenyl)methoxy]-(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | dimethyl-[(2-methylphenyl)methoxy]-(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 91703256 |
| Molecular Formula | C16H15F5OSi |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | dimethyl-[(2-methylphenyl)methoxy]-(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | Cc1ccccc1CO[Si](C)(C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H15F5OSi/c1-9-6-4-5-7-10(9)8-22-23(2,3)16-14(20)12(18)11(17)13(19)15(16)21/h4-7H,8H2,1-3H3 |
| InChIKey | RAQMHCJTYKXSNH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|