C27H24O7S — CID 91703648
[(2S,3R,4R,5R)-3-benzoyloxy-5-benzoylsulfanyl-2-methoxyoxan-4-yl] benzoate (PubChem CID 91703648) has the molecular formula C27H24O7S and a molecular weight of 492.55 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-3-benzoyloxy-5-benzoylsulfanyl-2-methoxyoxan-4-yl] benzoate.
| Compound Name | [(2S,3R,4R,5R)-3-benzoyloxy-5-benzoylsulfanyl-2-methoxyoxan-4-yl] benzoate |
|---|---|
| PubChem CID | 91703648 |
| Molecular Formula | C27H24O7S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | [(2S,3R,4R,5R)-3-benzoyloxy-5-benzoylsulfanyl-2-methoxyoxan-4-yl] benzoate |
| SMILES | CO[C@H]1OC[C@@H](SC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H24O7S/c1-31-27-23(34-25(29)19-13-7-3-8-14-19)22(33-24(28)18-11-5-2-6-12-18)21(17-32-27)35-26(30)20-15-9-4-10-16-20/h2-16,21-23,27H,17H2,1H3/t21-,22+,23-,27+/m1/s1 |
| InChIKey | NYATZIDVXFPXKZ-IDIXZGLXSA-N |
| XLogP | 4.38 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|