About ethoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane
ethoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane (PubChem CID 91703876) has the molecular formula C17H19F3O2Si
and a molecular weight of 340.42 g/mol. Its IUPAC name is ethoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane.
Molecular Properties
| Compound Name | ethoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane |
| PubChem CID | 91703876 |
| Molecular Formula | C17H19F3O2Si |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | ethoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane |
| SMILES | CCO[Si](OC(C)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19F3O2Si/c1-3-21-23(15-10-6-4-7-11-15,16-12-8-5-9-13-16)22-14(2)17(18,19)20/h4-14H,3H2,1-2H3 |
| InChIKey | XEOHOUGTVAHXRX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane?
The IUPAC name of ethoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane (CID 91703876) is ethoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane.
What is the SMILES notation for ethoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane?
The canonical SMILES for ethoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane is CCO[Si](OC(C)C(F)(F)F)(c1ccccc1)c1ccccc1.
What is the InChIKey of ethoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane?
The InChIKey is XEOHOUGTVAHXRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F3O2Si/c1-3-21-23(15-10-6-4-7-11-15,16-12-8-5-9-13-16)22-14(2)17(18,19)20/h4-14H,3H2,1-2H3.
What are the key properties of ethoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane?
ethoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane has a molecular weight of 340.42 g/mol, XLogP of 3.25, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane is sourced from PubChem (CID 91703876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).