About 5-[2-(4-aminophenyl)ethyl]-1H-1,2,4-triazol-3-amine
5-[2-(4-aminophenyl)ethyl]-1H-1,2,4-triazol-3-amine (PubChem CID 91704051) has the molecular formula C10H13N5
and a molecular weight of 203.25 g/mol. Its IUPAC name is 5-[2-(4-aminophenyl)ethyl]-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-[2-(4-aminophenyl)ethyl]-1H-1,2,4-triazol-3-amine |
| PubChem CID | 91704051 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 5-[2-(4-aminophenyl)ethyl]-1H-1,2,4-triazol-3-amine |
| SMILES | Nc1ccc(CCc2nc(N)n[nH]2)cc1 |
| InChI | InChI=1S/C10H13N5/c11-8-4-1-7(2-5-8)3-6-9-13-10(12)15-14-9/h1-2,4-5H,3,6,11H2,(H3,12,13,14,15) |
| InChIKey | SREQPWXANWRXAA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(4-aminophenyl)ethyl]-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4-aminophenyl)ethyl]-1H-1,2,4-triazol-3-amine?
The IUPAC name of 5-[2-(4-aminophenyl)ethyl]-1H-1,2,4-triazol-3-amine (CID 91704051) is 5-[2-(4-aminophenyl)ethyl]-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-[2-(4-aminophenyl)ethyl]-1H-1,2,4-triazol-3-amine?
The canonical SMILES for 5-[2-(4-aminophenyl)ethyl]-1H-1,2,4-triazol-3-amine is Nc1ccc(CCc2nc(N)n[nH]2)cc1.
What is the InChIKey of 5-[2-(4-aminophenyl)ethyl]-1H-1,2,4-triazol-3-amine?
The InChIKey is SREQPWXANWRXAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5/c11-8-4-1-7(2-5-8)3-6-9-13-10(12)15-14-9/h1-2,4-5H,3,6,11H2,(H3,12,13,14,15).
What are the key properties of 5-[2-(4-aminophenyl)ethyl]-1H-1,2,4-triazol-3-amine?
5-[2-(4-aminophenyl)ethyl]-1H-1,2,4-triazol-3-amine has a molecular weight of 203.25 g/mol, XLogP of 0.75, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4-aminophenyl)ethyl]-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 91704051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).