About 3-pentyl-4,5-dihydro-3H-2-benzofuran-1-one
3-pentyl-4,5-dihydro-3H-2-benzofuran-1-one (PubChem CID 91704075) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 3-pentyl-4,5-dihydro-3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 3-pentyl-4,5-dihydro-3H-2-benzofuran-1-one |
| PubChem CID | 91704075 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 3-pentyl-4,5-dihydro-3H-2-benzofuran-1-one |
| SMILES | CCCCCC1OC(=O)C2=C1CCC=C2 |
| InChI | InChI=1S/C13H18O2/c1-2-3-4-9-12-10-7-5-6-8-11(10)13(14)15-12/h6,8,12H,2-5,7,9H2,1H3 |
| InChIKey | LSRBNNXNGNVZQN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pentyl-4,5-dihydro-3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentyl-4,5-dihydro-3H-2-benzofuran-1-one?
The IUPAC name of 3-pentyl-4,5-dihydro-3H-2-benzofuran-1-one (CID 91704075) is 3-pentyl-4,5-dihydro-3H-2-benzofuran-1-one.
What is the SMILES notation for 3-pentyl-4,5-dihydro-3H-2-benzofuran-1-one?
The canonical SMILES for 3-pentyl-4,5-dihydro-3H-2-benzofuran-1-one is CCCCCC1OC(=O)C2=C1CCC=C2.
What is the InChIKey of 3-pentyl-4,5-dihydro-3H-2-benzofuran-1-one?
The InChIKey is LSRBNNXNGNVZQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-2-3-4-9-12-10-7-5-6-8-11(10)13(14)15-12/h6,8,12H,2-5,7,9H2,1H3.
What are the key properties of 3-pentyl-4,5-dihydro-3H-2-benzofuran-1-one?
3-pentyl-4,5-dihydro-3H-2-benzofuran-1-one has a molecular weight of 206.28 g/mol, XLogP of 3.14, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentyl-4,5-dihydro-3H-2-benzofuran-1-one is sourced from PubChem (CID 91704075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).