C17H19FN3S+ — CID 9170423
(3-cyano-4,6-dimethyl-2-sulfanylidene-1-pyridinyl)methyl-[(3-fluorophenyl)methyl]-methylazanium (PubChem CID 9170423) has the molecular formula C17H19FN3S+ and a molecular weight of 316.43 g/mol. Its IUPAC name is (3-cyano-4,6-dimethyl-2-sulfanylidene-1-pyridinyl)methyl-[(3-fluorophenyl)methyl]-methylazanium.
| Compound Name | (3-cyano-4,6-dimethyl-2-sulfanylidene-1-pyridinyl)methyl-[(3-fluorophenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9170423 |
| Molecular Formula | C17H19FN3S+ |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (3-cyano-4,6-dimethyl-2-sulfanylidene-1-pyridinyl)methyl-[(3-fluorophenyl)methyl]-methylazanium |
| SMILES | Cc1cc(C)n(C[NH+](C)Cc2cccc(F)c2)c(=S)c1C#N |
| InChI | InChI=1S/C17H18FN3S/c1-12-7-13(2)21(17(22)16(12)9-19)11-20(3)10-14-5-4-6-15(18)8-14/h4-8H,10-11H2,1-3H3/p+1 |
| InChIKey | AAGXTCQJDFHQNJ-UHFFFAOYSA-O |
| XLogP | 2.52 |
| TPSA | 33.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|