C16H22F4O4 — CID 91704241
1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2,2,3,3-tetrafluoropropyl) pentanedioate (PubChem CID 91704241) has the molecular formula C16H22F4O4 and a molecular weight of 354.34 g/mol. Its IUPAC name is 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2,2,3,3-tetrafluoropropyl) pentanedioate.
| Compound Name | 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2,2,3,3-tetrafluoropropyl) pentanedioate |
|---|---|
| PubChem CID | 91704241 |
| Molecular Formula | C16H22F4O4 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2,2,3,3-tetrafluoropropyl) pentanedioate |
| SMILES | CC1=C(COC(=O)CCCC(=O)OCC(F)(F)C(F)F)CCCC1 |
| InChI | InChI=1S/C16H22F4O4/c1-11-5-2-3-6-12(11)9-23-13(21)7-4-8-14(22)24-10-16(19,20)15(17)18/h15H,2-10H2,1H3 |
| InChIKey | NGSVOBXUWVVTJX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|