C18H22F8O4 — CID 91704263
1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate (PubChem CID 91704263) has the molecular formula C18H22F8O4 and a molecular weight of 454.35 g/mol. Its IUPAC name is 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate.
| Compound Name | 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
|---|---|
| PubChem CID | 91704263 |
| Molecular Formula | C18H22F8O4 |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
| SMILES | CC1=C(COC(=O)CCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)CCCC1 |
| InChI | InChI=1S/C18H22F8O4/c1-11-5-2-3-6-12(11)9-29-13(27)7-4-8-14(28)30-10-16(21,22)18(25,26)17(23,24)15(19)20/h15H,2-10H2,1H3 |
| InChIKey | DRQZZPSVBZJCHI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|