C19H25F7O2 — CID 91704353
(3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl)methyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91704353) has the molecular formula C19H25F7O2 and a molecular weight of 418.39 g/mol. Its IUPAC name is (3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl)methyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | (3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl)methyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91704353 |
| Molecular Formula | C19H25F7O2 |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | (3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl)methyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CC1(C)CCCC2(C)C(COC(=O)C(F)(F)C(F)(F)C(F)(F)F)C3CCC2C31 |
| InChI | InChI=1S/C19H25F7O2/c1-15(2)7-4-8-16(3)11-6-5-10(13(11)15)12(16)9-28-14(27)17(20,21)18(22,23)19(24,25)26/h10-13H,4-9H2,1-3H3 |
| InChIKey | UZBXZJGGLZIZQD-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|